(E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid

C16H22O5 — CID 125470550

IUPAC(E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid
SMILESCCOc1cc(/C(C)=C/C(=O)O)cc(OCC)c1OCC
InChIInChI=1S/C16H22O5/c1-5-19-13-9-12(11(4)8-15(17)18)10-14(20-6-2)16(13)21-7-3/h8-10H,5-7H2,1-4H3,(H,17,18)/b11-8+
InChIKeyVYWFETNFQXZRBL-DHZHZOJOSA-N
MW294.35 g/mol
LogP3.37
Rot. Bonds8

About (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid

(E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid (PubChem CID 125470550) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid
PubChem CID125470550
Molecular FormulaC16H22O5
Molecular Weight294.35 g/mol
Exact Mass294.15
IUPAC Name(E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid
SMILESCCOc1cc(/C(C)=C/C(=O)O)cc(OCC)c1OCC
InChIInChI=1S/C16H22O5/c1-5-19-13-9-12(11(4)8-15(17)18)10-14(20-6-2)16(13)21-7-3/h8-10H,5-7H2,1-4H3,(H,17,18)/b11-8+
InChIKeyVYWFETNFQXZRBL-DHZHZOJOSA-N
XLogP3.37
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.35
LogP ≤ 53.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid?
The IUPAC name of (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid (CID 125470550) is (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid.
What is the SMILES notation for (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid?
The canonical SMILES for (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid is CCOc1cc(/C(C)=C/C(=O)O)cc(OCC)c1OCC.
What is the InChIKey of (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid?
The InChIKey is VYWFETNFQXZRBL-DHZHZOJOSA-N. The full InChI is InChI=1S/C16H22O5/c1-5-19-13-9-12(11(4)8-15(17)18)10-14(20-6-2)16(13)21-7-3/h8-10H,5-7H2,1-4H3,(H,17,18)/b11-8+.
What are the key properties of (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid?
(E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid has a molecular weight of 294.35 g/mol, XLogP of 3.37, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(3,4,5-triethoxyphenyl)but-2-enoic acid is sourced from PubChem (CID 125470550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).