C23H31O5- — CID 18371149
(2E,4E,6E)-7-[3-tert-butyl-4-(1-methoxyethoxymethoxy)phenyl]-3-methylocta-2,4,6-trienoate (PubChem CID 18371149) has the molecular formula C23H31O5- and a molecular weight of 387.50 g/mol. Its IUPAC name is (2E,4E,6E)-7-[3-tert-butyl-4-(1-methoxyethoxymethoxy)phenyl]-3-methylocta-2,4,6-trienoate.
| Compound Name | (2E,4E,6E)-7-[3-tert-butyl-4-(1-methoxyethoxymethoxy)phenyl]-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 18371149 |
| Molecular Formula | C23H31O5- |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2E,4E,6E)-7-[3-tert-butyl-4-(1-methoxyethoxymethoxy)phenyl]-3-methylocta-2,4,6-trienoate |
| SMILES | COC(C)OCOc1ccc(/C(C)=C/C=C/C(C)=C/C(=O)[O-])cc1C(C)(C)C |
| InChI | InChI=1S/C23H32O5/c1-16(13-22(24)25)9-8-10-17(2)19-11-12-21(20(14-19)23(4,5)6)28-15-27-18(3)26-7/h8-14,18H,15H2,1-7H3,(H,24,25)/p-1/b9-8+,16-13+,17-10+ |
| InChIKey | MSTQDNKVKHBCNL-HXGXTQCYSA-M |
| XLogP | 3.99 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|