C24H36O — CID 143583906
1,3-ditert-butyl-2-methoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene (PubChem CID 143583906) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-methoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene.
| Compound Name | 1,3-ditert-butyl-2-methoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 143583906 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | 1,3-ditert-butyl-2-methoxy-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene |
| SMILES | C/C=C(C)/C=C/C=C(\C)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H36O/c1-11-17(2)13-12-14-18(3)19-15-20(23(4,5)6)22(25-10)21(16-19)24(7,8)9/h11-16H,1-10H3/b13-12+,17-11+,18-14+ |
| InChIKey | NFGDEWKZUNXKAG-FZYVWNESSA-N |
| XLogP | 7.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|