C30H40O — CID 59926363
1-tert-butyl-3-[(4-tert-butylphenyl)methoxy]-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene (PubChem CID 59926363) has the molecular formula C30H40O and a molecular weight of 416.65 g/mol. Its IUPAC name is 1-tert-butyl-3-[(4-tert-butylphenyl)methoxy]-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene.
| Compound Name | 1-tert-butyl-3-[(4-tert-butylphenyl)methoxy]-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene |
|---|---|
| PubChem CID | 59926363 |
| Molecular Formula | C30H40O |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 1-tert-butyl-3-[(4-tert-butylphenyl)methoxy]-5-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]benzene |
| SMILES | C/C=C(C)/C=C/C=C(\C)c1cc(OCc2ccc(C(C)(C)C)cc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H40O/c1-10-22(2)12-11-13-23(3)25-18-27(30(7,8)9)20-28(19-25)31-21-24-14-16-26(17-15-24)29(4,5)6/h10-20H,21H2,1-9H3/b12-11+,22-10+,23-13+ |
| InChIKey | HYWZDDPHJJBURT-HXEJSKKBSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|