C23H30O — CID 144776562
1-tert-butyl-4-[[4-(3-methylpent-1-en-3-yl)phenoxy]methyl]benzene (PubChem CID 144776562) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-tert-butyl-4-[[4-(3-methylpent-1-en-3-yl)phenoxy]methyl]benzene.
| Compound Name | 1-tert-butyl-4-[[4-(3-methylpent-1-en-3-yl)phenoxy]methyl]benzene |
|---|---|
| PubChem CID | 144776562 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 1-tert-butyl-4-[[4-(3-methylpent-1-en-3-yl)phenoxy]methyl]benzene |
| SMILES | C=CC(C)(CC)c1ccc(OCc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H30O/c1-7-23(6,8-2)20-13-15-21(16-14-20)24-17-18-9-11-19(12-10-18)22(3,4)5/h7,9-16H,1,8,17H2,2-6H3 |
| InChIKey | YANXVCZKLGBVFK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|