C37H46O4 — CID 142213438
1,3-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzene;(3Z,5Z)-2,5-dimethylhepta-1,3,5-triene;3-hydroxy-3-methylbutan-2-one (PubChem CID 142213438) has the molecular formula C37H46O4 and a molecular weight of 554.77 g/mol. Its IUPAC name is 1,3-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzene;(3Z,5Z)-2,5-dimethylhepta-1,3,5-triene;3-hydroxy-3-methylbutan-2-one.
| Compound Name | 1,3-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzene;(3Z,5Z)-2,5-dimethylhepta-1,3,5-triene;3-hydroxy-3-methylbutan-2-one |
|---|---|
| PubChem CID | 142213438 |
| Molecular Formula | C37H46O4 |
| Molecular Weight | 554.77 g/mol |
| Exact Mass | 554.34 |
| IUPAC Name | 1,3-bis(phenylmethoxy)-5-prop-1-en-2-ylbenzene;(3Z,5Z)-2,5-dimethylhepta-1,3,5-triene;3-hydroxy-3-methylbutan-2-one |
| SMILES | C=C(C)/C=C\C(C)=C/C.C=C(C)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1.CC(=O)C(C)(C)O |
| InChI | InChI=1S/C23H22O2.C9H14.C5H10O2/c1-18(2)21-13-22(24-16-19-9-5-3-6-10-19)15-23(14-21)25-17-20-11-7-4-8-12-20;1-5-9(4)7-6-8(2)3;1-4(6)5(2,3)7/h3-15H,1,16-17H2,2H3;5-7H,2H2,1,3-4H3;7H,1-3H3/b;7-6-,9-5-; |
| InChIKey | MHBDJBZIOPCQBR-AIRSJLMGSA-N |
| XLogP | 9.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.77 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|