C18H20O3 — CID 173419509
(2E)-3,7-dimethyl-9-(5-oxo-2-bicyclo[2.2.1]hept-2-enyl)nona-2,4,6,8-tetraenoic acid (PubChem CID 173419509) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-9-(5-oxo-2-bicyclo[2.2.1]hept-2-enyl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E)-3,7-dimethyl-9-(5-oxo-2-bicyclo[2.2.1]hept-2-enyl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 173419509 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2E)-3,7-dimethyl-9-(5-oxo-2-bicyclo[2.2.1]hept-2-enyl)nona-2,4,6,8-tetraenoic acid |
| SMILES | CC(C=CC1=CC2CC1CC2=O)=CC=C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C18H20O3/c1-12(4-3-5-13(2)8-18(20)21)6-7-14-9-16-10-15(14)11-17(16)19/h3-9,15-16H,10-11H2,1-2H3,(H,20,21)/b5-3?,7-6?,12-4?,13-8+ |
| InChIKey | JBDVQTRYTOEIDI-CROLADHVSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|