C19H20Cl2O3 — CID 6438591
(2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 6438591) has the molecular formula C19H20Cl2O3 and a molecular weight of 367.27 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 6438591 |
| Molecular Formula | C19H20Cl2O3 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | (2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | COc1cc(Cl)c(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)c(Cl)c1C |
| InChI | InChI=1S/C19H20Cl2O3/c1-12(6-5-7-13(2)10-18(22)23)8-9-15-16(20)11-17(24-4)14(3)19(15)21/h5-11H,1-4H3,(H,22,23)/b7-5+,9-8+,12-6+,13-10+ |
| InChIKey | UIYDAJBSZLUITG-AWLPPDDPSA-N |
| XLogP | 5.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|