C21H24Cl2FNO2 — CID 20536100
(2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-N-ethyl-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenamide (PubChem CID 20536100) has the molecular formula C21H24Cl2FNO2 and a molecular weight of 412.33 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-N-ethyl-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-N-ethyl-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 20536100 |
| Molecular Formula | C21H24Cl2FNO2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | (2E,4E,6E,8E)-9-(2,6-dichloro-4-methoxy-3-methylphenyl)-N-ethyl-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenamide |
| SMILES | CCNC(=O)/C=C(C)/C=C/C(F)=C(C)\C=C\c1c(Cl)cc(OC)c(C)c1Cl |
| InChI | InChI=1S/C21H24Cl2FNO2/c1-6-25-20(26)11-13(2)7-10-18(24)14(3)8-9-16-17(22)12-19(27-5)15(4)21(16)23/h7-12H,6H2,1-5H3,(H,25,26)/b9-8+,10-7+,13-11+,18-14+ |
| InChIKey | CMPBTUAVSIEFJG-DJPUTDNWSA-N |
| XLogP | 6.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|