C23H28F2O3 — CID 13018667
ethyl (2E,4Z,6Z,8E)-4,6-difluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 13018667) has the molecular formula C23H28F2O3 and a molecular weight of 390.47 g/mol. Its IUPAC name is ethyl (2E,4Z,6Z,8E)-4,6-difluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4Z,6Z,8E)-4,6-difluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 13018667 |
| Molecular Formula | C23H28F2O3 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | ethyl (2E,4Z,6Z,8E)-4,6-difluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C(C)/C(F)=C/C(F)=C(C)/C=C/c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C23H28F2O3/c1-8-28-23(26)12-16(4)21(25)13-20(24)14(2)9-10-19-15(3)11-22(27-7)18(6)17(19)5/h9-13H,8H2,1-7H3/b10-9+,16-12+,20-14-,21-13- |
| InChIKey | AQXNILFIYOYSHI-BAQCHRHCSA-N |
| XLogP | 6.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|