C13H15FO3 — CID 20508469
(E)-2-fluoro-3-(4-methoxy-2,3,6-trimethylphenyl)prop-2-enoic acid (PubChem CID 20508469) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is (E)-2-fluoro-3-(4-methoxy-2,3,6-trimethylphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-fluoro-3-(4-methoxy-2,3,6-trimethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 20508469 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (E)-2-fluoro-3-(4-methoxy-2,3,6-trimethylphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C)c(/C=C(/F)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C13H15FO3/c1-7-5-12(17-4)9(3)8(2)10(7)6-11(14)13(15)16/h5-6H,1-4H3,(H,15,16)/b11-6+ |
| InChIKey | NWUWXLYIOUXMRF-IZZDOVSWSA-N |
| XLogP | 3.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|