C25H24O3 — CID 84820412
4-[4-[(E)-2-(4-methoxy-2,3,6-trimethylphenyl)ethenyl]phenyl]benzoic acid (PubChem CID 84820412) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is 4-[4-[(E)-2-(4-methoxy-2,3,6-trimethylphenyl)ethenyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[(E)-2-(4-methoxy-2,3,6-trimethylphenyl)ethenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 84820412 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-[4-[(E)-2-(4-methoxy-2,3,6-trimethylphenyl)ethenyl]phenyl]benzoic acid |
| SMILES | COc1cc(C)c(/C=C/c2ccc(-c3ccc(C(=O)O)cc3)cc2)c(C)c1C |
| InChI | InChI=1S/C25H24O3/c1-16-15-24(28-4)18(3)17(2)23(16)14-7-19-5-8-20(9-6-19)21-10-12-22(13-11-21)25(26)27/h5-15H,1-4H3,(H,26,27)/b14-7+ |
| InChIKey | FKUYDPZMQAWVIO-VGOFMYFVSA-N |
| XLogP | 6.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|