C18H23FO3 — CID 13065012
ethyl (2Z,4E)-2-fluoro-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienoate (PubChem CID 13065012) has the molecular formula C18H23FO3 and a molecular weight of 306.38 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-fluoro-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-2-fluoro-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 13065012 |
| Molecular Formula | C18H23FO3 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | ethyl (2Z,4E)-2-fluoro-5-(4-methoxy-2,3,6-trimethylphenyl)-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(F)=C(C)/C=C/c1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C18H23FO3/c1-7-22-18(20)17(19)11(2)8-9-15-12(3)10-16(21-6)14(5)13(15)4/h8-10H,7H2,1-6H3/b9-8+,17-11- |
| InChIKey | RSVHUADMIGBSMR-JMAVEDQASA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|