C14H15FO2 — CID 84820398
ethyl (2Z,4E)-2-fluoro-3-methyl-5-phenylpenta-2,4-dienoate (PubChem CID 84820398) has the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-fluoro-3-methyl-5-phenylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-2-fluoro-3-methyl-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 84820398 |
| Molecular Formula | C14H15FO2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | ethyl (2Z,4E)-2-fluoro-3-methyl-5-phenylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(F)=C(C)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H15FO2/c1-3-17-14(16)13(15)11(2)9-10-12-7-5-4-6-8-12/h4-10H,3H2,1-2H3/b10-9+,13-11- |
| InChIKey | CODNAEYXEOSAGI-LTCRFSFDSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|