C20H25FO3 — CID 54554255
4-ethyl-2-fluoro-7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid (PubChem CID 54554255) has the molecular formula C20H25FO3 and a molecular weight of 332.42 g/mol. Its IUPAC name is 4-ethyl-2-fluoro-7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid.
| Compound Name | 4-ethyl-2-fluoro-7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54554255 |
| Molecular Formula | C20H25FO3 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-ethyl-2-fluoro-7-(4-methoxy-2,3,6-trimethylphenyl)-5-methylhepta-2,4,6-trienoic acid |
| SMILES | CCC(C=C(F)C(=O)O)=C(C)C=Cc1c(C)cc(OC)c(C)c1C |
| InChI | InChI=1S/C20H25FO3/c1-7-16(11-18(21)20(22)23)12(2)8-9-17-13(3)10-19(24-6)15(5)14(17)4/h8-11H,7H2,1-6H3,(H,22,23) |
| InChIKey | ZMAZCLUEOQVETE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|