C21H25FO3 — CID 88735385
(2E,4E,6Z,8E)-6-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 88735385) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-6-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6Z,8E)-6-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 88735385 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2E,4E,6Z,8E)-6-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | COc1cc(C)c(/C=C/C(C)=C(F)/C=C/C(C)=C/C(=O)O)c(C)c1C |
| InChI | InChI=1S/C21H25FO3/c1-13(11-21(23)24)7-10-19(22)14(2)8-9-18-15(3)12-20(25-6)17(5)16(18)4/h7-12H,1-6H3,(H,23,24)/b9-8+,10-7+,13-11+,19-14- |
| InChIKey | ZZSVXJFEYUAKHM-UMAVUTBLSA-N |
| XLogP | 5.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|