C20H22ClFO3 — CID 54259181
9-(5-chloro-4-methoxy-2,3-dimethylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 54259181) has the molecular formula C20H22ClFO3 and a molecular weight of 364.84 g/mol. Its IUPAC name is 9-(5-chloro-4-methoxy-2,3-dimethylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | 9-(5-chloro-4-methoxy-2,3-dimethylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 54259181 |
| Molecular Formula | C20H22ClFO3 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 9-(5-chloro-4-methoxy-2,3-dimethylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | COc1c(Cl)cc(C=CC(C)=C(F)C=CC(C)=CC(=O)O)c(C)c1C |
| InChI | InChI=1S/C20H22ClFO3/c1-12(10-19(23)24)6-9-18(22)13(2)7-8-16-11-17(21)20(25-5)15(4)14(16)3/h6-11H,1-5H3,(H,23,24) |
| InChIKey | RCGKWUYIZWULLQ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|