C22H27FO3 — CID 54269110
5-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,6,7-trimethylnona-2,4,6,8-tetraenoic acid (PubChem CID 54269110) has the molecular formula C22H27FO3 and a molecular weight of 358.45 g/mol. Its IUPAC name is 5-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,6,7-trimethylnona-2,4,6,8-tetraenoic acid.
| Compound Name | 5-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,6,7-trimethylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 54269110 |
| Molecular Formula | C22H27FO3 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5-fluoro-9-(4-methoxy-2,3,6-trimethylphenyl)-3,6,7-trimethylnona-2,4,6,8-tetraenoic acid |
| SMILES | COc1cc(C)c(C=CC(C)=C(C)C(F)=CC(C)=CC(=O)O)c(C)c1C |
| InChI | InChI=1S/C22H27FO3/c1-13(11-22(24)25)10-20(23)16(4)14(2)8-9-19-15(3)12-21(26-7)18(6)17(19)5/h8-12H,1-7H3,(H,24,25) |
| InChIKey | RIWYAWDWOBMLFJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|