C21H25LiO3 — CID 23701574
lithium (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 23701574) has the molecular formula C21H25LiO3 and a molecular weight of 332.37 g/mol. Its IUPAC name is lithium (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | lithium (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 23701574 |
| Molecular Formula | C21H25LiO3 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | lithium (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | COc1cc(C)c(/C=C/C(C)=C/C=C/C(C)=C/C(=O)[O-])c(C)c1C.[Li+] |
| InChI | InChI=1S/C21H26O3.Li/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4;/h7-13H,1-6H3,(H,22,23);/q;+1/p-1/b9-7+,11-10+,14-8+,15-12+; |
| InChIKey | GYEDSVAIEOIIMY-WMOHYEITSA-M |
| XLogP | 0.84 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|