C28H30F3NO3 — CID 87125006
(2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-N-[3-(trifluoromethoxy)phenyl]nona-2,4,6,8-tetraenamide (PubChem CID 87125006) has the molecular formula C28H30F3NO3 and a molecular weight of 485.55 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-N-[3-(trifluoromethoxy)phenyl]nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-N-[3-(trifluoromethoxy)phenyl]nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 87125006 |
| Molecular Formula | C28H30F3NO3 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethyl-N-[3-(trifluoromethoxy)phenyl]nona-2,4,6,8-tetraenamide |
| SMILES | COc1cc(C)c(/C=C/C(C)=C/C=C/C(C)=C/C(=O)Nc2cccc(OC(F)(F)F)c2)c(C)c1C |
| InChI | InChI=1S/C28H30F3NO3/c1-18(13-14-25-20(3)16-26(34-6)22(5)21(25)4)9-7-10-19(2)15-27(33)32-23-11-8-12-24(17-23)35-28(29,30)31/h7-17H,1-6H3,(H,32,33)/b10-7+,14-13+,18-9+,19-15+ |
| InChIKey | LZVFVMFYXLMYFC-QYKWGFQXSA-N |
| XLogP | 7.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|