C29H30F3NO5 — CID 76703398
2-[[9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethoxy)benzoic acid (PubChem CID 76703398) has the molecular formula C29H30F3NO5 and a molecular weight of 529.56 g/mol. Its IUPAC name is 2-[[9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-[[9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 76703398 |
| Molecular Formula | C29H30F3NO5 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2-[[9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoyl]amino]-5-(trifluoromethoxy)benzoic acid |
| SMILES | COc1cc(C)c(C=CC(C)=CC=CC(C)=CC(=O)Nc2ccc(OC(F)(F)F)cc2C(=O)O)c(C)c1C |
| InChI | InChI=1S/C29H30F3NO5/c1-17(10-12-23-19(3)15-26(37-6)21(5)20(23)4)8-7-9-18(2)14-27(34)33-25-13-11-22(38-29(30,31)32)16-24(25)28(35)36/h7-16H,1-6H3,(H,33,34)(H,35,36) |
| InChIKey | UABCARBWXLSYJW-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|