C19H19Cl2FO2 — CID 54211374
9-(2,6-dichloro-4-methoxy-3-methylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenal (PubChem CID 54211374) has the molecular formula C19H19Cl2FO2 and a molecular weight of 369.26 g/mol. Its IUPAC name is 9-(2,6-dichloro-4-methoxy-3-methylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenal.
| Compound Name | 9-(2,6-dichloro-4-methoxy-3-methylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 54211374 |
| Molecular Formula | C19H19Cl2FO2 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 9-(2,6-dichloro-4-methoxy-3-methylphenyl)-6-fluoro-3,7-dimethylnona-2,4,6,8-tetraenal |
| SMILES | COc1cc(Cl)c(C=CC(C)=C(F)C=CC(C)=CC=O)c(Cl)c1C |
| InChI | InChI=1S/C19H19Cl2FO2/c1-12(9-10-23)5-8-17(22)13(2)6-7-15-16(20)11-18(24-4)14(3)19(15)21/h5-11H,1-4H3 |
| InChIKey | PWEJNJHQGCORMY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|