C10H20N2O — CID 151463961
N',N',2-trimethylhept-2-enehydrazide (PubChem CID 151463961) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N',N',2-trimethylhept-2-enehydrazide.
| Compound Name | N',N',2-trimethylhept-2-enehydrazide |
|---|---|
| PubChem CID | 151463961 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N',N',2-trimethylhept-2-enehydrazide |
| SMILES | CCCCC=C(C)C(=O)NN(C)C |
| InChI | InChI=1S/C10H20N2O/c1-5-6-7-8-9(2)10(13)11-12(3)4/h8H,5-7H2,1-4H3,(H,11,13) |
| InChIKey | PJBGFOUQYLSPHK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|