About (E)-5-ethyldec-4-ene
(E)-5-ethyldec-4-ene (PubChem CID 173194379) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is (E)-5-ethyldec-4-ene.
Molecular Properties
| Compound Name | (E)-5-ethyldec-4-ene |
| PubChem CID | 173194379 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | (E)-5-ethyldec-4-ene |
| SMILES | CCC/C=C(\CC)CCCCC |
| InChI | InChI=1S/C12H24/c1-4-7-9-11-12(6-3)10-8-5-2/h10H,4-9,11H2,1-3H3/b12-10+ |
| InChIKey | BIGSUIRZNLGMGU-ZRDIBKRKSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-ethyldec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-ethyldec-4-ene?
The IUPAC name of (E)-5-ethyldec-4-ene (CID 173194379) is (E)-5-ethyldec-4-ene.
What is the SMILES notation for (E)-5-ethyldec-4-ene?
The canonical SMILES for (E)-5-ethyldec-4-ene is CCC/C=C(\CC)CCCCC.
What is the InChIKey of (E)-5-ethyldec-4-ene?
The InChIKey is BIGSUIRZNLGMGU-ZRDIBKRKSA-N. The full InChI is InChI=1S/C12H24/c1-4-7-9-11-12(6-3)10-8-5-2/h10H,4-9,11H2,1-3H3/b12-10+.
What are the key properties of (E)-5-ethyldec-4-ene?
(E)-5-ethyldec-4-ene has a molecular weight of 168.32 g/mol, XLogP of 4.70, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-ethyldec-4-ene is sourced from PubChem (CID 173194379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).