About (Z)-6-ethylundec-5-ene
(Z)-6-ethylundec-5-ene (PubChem CID 102395453) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is (Z)-6-ethylundec-5-ene.
Molecular Properties
| Compound Name | (Z)-6-ethylundec-5-ene |
| PubChem CID | 102395453 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | (Z)-6-ethylundec-5-ene |
| SMILES | CCCC/C=C(/CC)CCCCC |
| InChI | InChI=1S/C13H26/c1-4-7-9-11-13(6-3)12-10-8-5-2/h11H,4-10,12H2,1-3H3/b13-11- |
| InChIKey | SACOYADCLZCMDK-QBFSEMIESA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-ethylundec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-ethylundec-5-ene?
The IUPAC name of (Z)-6-ethylundec-5-ene (CID 102395453) is (Z)-6-ethylundec-5-ene.
What is the SMILES notation for (Z)-6-ethylundec-5-ene?
The canonical SMILES for (Z)-6-ethylundec-5-ene is CCCC/C=C(/CC)CCCCC.
What is the InChIKey of (Z)-6-ethylundec-5-ene?
The InChIKey is SACOYADCLZCMDK-QBFSEMIESA-N. The full InChI is InChI=1S/C13H26/c1-4-7-9-11-13(6-3)12-10-8-5-2/h11H,4-10,12H2,1-3H3/b13-11-.
What are the key properties of (Z)-6-ethylundec-5-ene?
(Z)-6-ethylundec-5-ene has a molecular weight of 182.35 g/mol, XLogP of 5.09, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-ethylundec-5-ene is sourced from PubChem (CID 102395453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).