About (E)-3-ethyloct-2-en-1-ol
(E)-3-ethyloct-2-en-1-ol (PubChem CID 13383767) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is (E)-3-ethyloct-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-3-ethyloct-2-en-1-ol |
| PubChem CID | 13383767 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (E)-3-ethyloct-2-en-1-ol |
| SMILES | CCCCC/C(=C/CO)CC |
| InChI | InChI=1S/C10H20O/c1-3-5-6-7-10(4-2)8-9-11/h8,11H,3-7,9H2,1-2H3/b10-8+ |
| InChIKey | GKQAWLUXFZALGE-CSKARUKUSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-ethyloct-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-ethyloct-2-en-1-ol?
The IUPAC name of (E)-3-ethyloct-2-en-1-ol (CID 13383767) is (E)-3-ethyloct-2-en-1-ol.
What is the SMILES notation for (E)-3-ethyloct-2-en-1-ol?
The canonical SMILES for (E)-3-ethyloct-2-en-1-ol is CCCCC/C(=C/CO)CC.
What is the InChIKey of (E)-3-ethyloct-2-en-1-ol?
The InChIKey is GKQAWLUXFZALGE-CSKARUKUSA-N. The full InChI is InChI=1S/C10H20O/c1-3-5-6-7-10(4-2)8-9-11/h8,11H,3-7,9H2,1-2H3/b10-8+.
What are the key properties of (E)-3-ethyloct-2-en-1-ol?
(E)-3-ethyloct-2-en-1-ol has a molecular weight of 156.27 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-ethyloct-2-en-1-ol is sourced from PubChem (CID 13383767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).