About (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine
(Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine (PubChem CID 87744529) has the molecular formula C12H25N
and a molecular weight of 183.34 g/mol. Its IUPAC name is (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine |
| PubChem CID | 87744529 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine |
| SMILES | CCCCC/C(=C\CN(C)C)CC |
| InChI | InChI=1S/C12H25N/c1-5-7-8-9-12(6-2)10-11-13(3)4/h10H,5-9,11H2,1-4H3/b12-10- |
| InChIKey | SGUJIURYWQCFLU-BENRWUELSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine?
The IUPAC name of (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine (CID 87744529) is (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine.
What is the SMILES notation for (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine?
The canonical SMILES for (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine is CCCCC/C(=C\CN(C)C)CC.
What is the InChIKey of (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine?
The InChIKey is SGUJIURYWQCFLU-BENRWUELSA-N. The full InChI is InChI=1S/C12H25N/c1-5-7-8-9-12(6-2)10-11-13(3)4/h10H,5-9,11H2,1-4H3/b12-10-.
What are the key properties of (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine?
(Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine has a molecular weight of 183.34 g/mol, XLogP of 3.46, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-ethyl-N,N-dimethyloct-2-en-1-amine is sourced from PubChem (CID 87744529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).