About dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane
dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane (PubChem CID 71442006) has the molecular formula C26H32Si
and a molecular weight of 372.63 g/mol. Its IUPAC name is dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane.
Molecular Properties
| Compound Name | dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane |
| PubChem CID | 71442006 |
| Molecular Formula | C26H32Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane |
| SMILES | CCCC=C(CCC)C(=C[Si](C)(C)C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32Si/c1-5-7-17-24(14-6-2)26(25-18-12-9-13-19-25)22-27(3,4)21-20-23-15-10-8-11-16-23/h8-13,15-19,22H,5-7,14H2,1-4H3 |
| InChIKey | OBYBTZHAKHBYFG-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane?
The IUPAC name of dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane (CID 71442006) is dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane.
What is the SMILES notation for dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane?
The canonical SMILES for dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane is CCCC=C(CCC)C(=C[Si](C)(C)C#Cc1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane?
The InChIKey is OBYBTZHAKHBYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32Si/c1-5-7-17-24(14-6-2)26(25-18-12-9-13-19-25)22-27(3,4)21-20-23-15-10-8-11-16-23/h8-13,15-19,22H,5-7,14H2,1-4H3.
What are the key properties of dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane?
dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane has a molecular weight of 372.63 g/mol, XLogP of 7.44, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane is sourced from PubChem (CID 71442006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).