C26H32Si — CID 71442006
dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane (PubChem CID 71442006) has the molecular formula C26H32Si and a molecular weight of 372.63 g/mol. Its IUPAC name is dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane.
| Compound Name | dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane |
|---|---|
| PubChem CID | 71442006 |
| Molecular Formula | C26H32Si |
| Molecular Weight | 372.63 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | dimethyl-(2-phenylethynyl)-(2-phenyl-3-propylhepta-1,3-dienyl)silane |
| SMILES | CCCC=C(CCC)C(=C[Si](C)(C)C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32Si/c1-5-7-17-24(14-6-2)26(25-18-12-9-13-19-25)22-27(3,4)21-20-23-15-10-8-11-16-23/h8-13,15-19,22H,5-7,14H2,1-4H3 |
| InChIKey | OBYBTZHAKHBYFG-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|