C38H41NSi — CID 102310560
(E)-4-[dimethyl-[2-(4-propylphenyl)ethynyl]silyl]-1,1-diphenyl-3-(4-propylphenyl)but-3-en-2-imine (PubChem CID 102310560) has the molecular formula C38H41NSi and a molecular weight of 539.84 g/mol. Its IUPAC name is (E)-4-[dimethyl-[2-(4-propylphenyl)ethynyl]silyl]-1,1-diphenyl-3-(4-propylphenyl)but-3-en-2-imine.
| Compound Name | (E)-4-[dimethyl-[2-(4-propylphenyl)ethynyl]silyl]-1,1-diphenyl-3-(4-propylphenyl)but-3-en-2-imine |
|---|---|
| PubChem CID | 102310560 |
| Molecular Formula | C38H41NSi |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | (E)-4-[dimethyl-[2-(4-propylphenyl)ethynyl]silyl]-1,1-diphenyl-3-(4-propylphenyl)but-3-en-2-imine |
| SMILES | [H]/N=C(C(=C/[Si](C)(C)C#Cc1ccc(CCC)cc1)/c1ccc(CCC)cc1)\C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H41NSi/c1-5-13-30-19-21-32(22-20-30)27-28-40(3,4)29-36(33-25-23-31(14-6-2)24-26-33)38(39)37(34-15-9-7-10-16-34)35-17-11-8-12-18-35/h7-12,15-26,29,37,39H,5-6,13-14H2,1-4H3/b36-29+,39-38- |
| InChIKey | VFZMCMACWQUGLY-DHONAANYSA-N |
| XLogP | 9.67 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|