C14H18S — CID 142266398
1-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-4-propylbenzene (PubChem CID 142266398) has the molecular formula C14H18S and a molecular weight of 218.36 g/mol. Its IUPAC name is 1-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-4-propylbenzene.
| Compound Name | 1-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-4-propylbenzene |
|---|---|
| PubChem CID | 142266398 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[(1E)-1-methylsulfanylbuta-1,3-dien-2-yl]-4-propylbenzene |
| SMILES | C=C/C(=C\SC)c1ccc(CCC)cc1 |
| InChI | InChI=1S/C14H18S/c1-4-6-12-7-9-14(10-8-12)13(5-2)11-15-3/h5,7-11H,2,4,6H2,1,3H3/b13-11+ |
| InChIKey | WOZGMYFCYNXUGB-ACCUITESSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|