C20H25N — CID 167185306
2-[(2E)-3-(4-pentylphenyl)penta-2,4-dienyl]-1H-pyrrole (PubChem CID 167185306) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-[(2E)-3-(4-pentylphenyl)penta-2,4-dienyl]-1H-pyrrole.
| Compound Name | 2-[(2E)-3-(4-pentylphenyl)penta-2,4-dienyl]-1H-pyrrole |
|---|---|
| PubChem CID | 167185306 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-[(2E)-3-(4-pentylphenyl)penta-2,4-dienyl]-1H-pyrrole |
| SMILES | C=C/C(=C\Cc1ccc[nH]1)c1ccc(CCCCC)cc1 |
| InChI | InChI=1S/C20H25N/c1-3-5-6-8-17-10-12-19(13-11-17)18(4-2)14-15-20-9-7-16-21-20/h4,7,9-14,16,21H,2-3,5-6,8,15H2,1H3/b18-14+ |
| InChIKey | PQWUGXCDPCPIFQ-NBVRZTHBSA-N |
| XLogP | 5.56 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|