C18H34Si2 — CID 53401400
trimethyl-[3-propyl-2-(2-trimethylsilylethynyl)hepta-1,3-dienyl]silane (PubChem CID 53401400) has the molecular formula C18H34Si2 and a molecular weight of 306.64 g/mol. Its IUPAC name is trimethyl-[3-propyl-2-(2-trimethylsilylethynyl)hepta-1,3-dienyl]silane.
| Compound Name | trimethyl-[3-propyl-2-(2-trimethylsilylethynyl)hepta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 53401400 |
| Molecular Formula | C18H34Si2 |
| Molecular Weight | 306.64 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | trimethyl-[3-propyl-2-(2-trimethylsilylethynyl)hepta-1,3-dienyl]silane |
| SMILES | CCCC=C(CCC)C(C#C[Si](C)(C)C)=C[Si](C)(C)C |
| InChI | InChI=1S/C18H34Si2/c1-9-11-13-17(12-10-2)18(16-20(6,7)8)14-15-19(3,4)5/h13,16H,9-12H2,1-8H3 |
| InChIKey | LOLPFCLUORHSSR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|