C13H25N — CID 166865540
(Z,4Z)-4-ethylidene-3-propyloct-2-en-1-amine (PubChem CID 166865540) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (Z,4Z)-4-ethylidene-3-propyloct-2-en-1-amine.
| Compound Name | (Z,4Z)-4-ethylidene-3-propyloct-2-en-1-amine |
|---|---|
| PubChem CID | 166865540 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (Z,4Z)-4-ethylidene-3-propyloct-2-en-1-amine |
| SMILES | C/C=C(CCCC)\C(=C/CN)CCC |
| InChI | InChI=1S/C13H25N/c1-4-7-9-12(6-3)13(8-5-2)10-11-14/h6,10H,4-5,7-9,11,14H2,1-3H3/b12-6-,13-10- |
| InChIKey | BDSFYDLWFVMKLC-HVZNDUSUSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|