C25H36N2O8 — CID 11720151
diethyl 2-acetamido-2-[(Z)-3-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]propanedioate (PubChem CID 11720151) has the molecular formula C25H36N2O8 and a molecular weight of 492.57 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(Z)-3-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(Z)-3-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]propanedioate |
|---|---|
| PubChem CID | 11720151 |
| Molecular Formula | C25H36N2O8 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | diethyl 2-acetamido-2-[(Z)-3-(4-methoxyphenyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]but-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C(\CNC(=O)OC(C)(C)C)c1ccc(OC)cc1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C25H36N2O8/c1-8-33-21(29)25(27-17(3)28,22(30)34-9-2)15-14-19(16-26-23(31)35-24(4,5)6)18-10-12-20(32-7)13-11-18/h10-14H,8-9,15-16H2,1-7H3,(H,26,31)(H,27,28)/b19-14+ |
| InChIKey | XAMBIXDVNPDKNY-XMHGGMMESA-N |
| XLogP | 2.99 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|