C15H21NO3 — CID 16687001
tert-butyl N-[3-deuterio-2-(4-methoxyphenyl)prop-2-enyl]carbamate (PubChem CID 16687001) has the molecular formula C15H21NO3 and a molecular weight of 264.34 g/mol. Its IUPAC name is tert-butyl N-[3-deuterio-2-(4-methoxyphenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-deuterio-2-(4-methoxyphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 16687001 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | tert-butyl N-[3-deuterio-2-(4-methoxyphenyl)prop-2-enyl]carbamate |
| SMILES | [2H]/C=C(\CNC(=O)OC(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H21NO3/c1-11(10-16-14(17)19-15(2,3)4)12-6-8-13(18-5)9-7-12/h6-9H,1,10H2,2-5H3,(H,16,17)/i1D/b11-1+ |
| InChIKey | GJZXCHLNUIQBFK-KYOWOKMGSA-N |
| XLogP | 3.23 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |