C26H35NO7 — CID 67694991
diethyl 2-(6-methoxynaphthalen-2-yl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate (PubChem CID 67694991) has the molecular formula C26H35NO7 and a molecular weight of 473.57 g/mol. Its IUPAC name is diethyl 2-(6-methoxynaphthalen-2-yl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate.
| Compound Name | diethyl 2-(6-methoxynaphthalen-2-yl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate |
|---|---|
| PubChem CID | 67694991 |
| Molecular Formula | C26H35NO7 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | diethyl 2-(6-methoxynaphthalen-2-yl)-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]propanedioate |
| SMILES | CCOC(=O)C(CCCNC(=O)OC(C)(C)C)(C(=O)OCC)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C26H35NO7/c1-7-32-22(28)26(23(29)33-8-2,14-9-15-27-24(30)34-25(3,4)5)20-12-10-19-17-21(31-6)13-11-18(19)16-20/h10-13,16-17H,7-9,14-15H2,1-6H3,(H,27,30) |
| InChIKey | QPNXREHBGLEUTC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|