C21H23NO5 — CID 57250494
ethyl 2-[3,3-bis(4-methoxyphenyl)prop-2-enoylamino]acetate (PubChem CID 57250494) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 2-[3,3-bis(4-methoxyphenyl)prop-2-enoylamino]acetate.
| Compound Name | ethyl 2-[3,3-bis(4-methoxyphenyl)prop-2-enoylamino]acetate |
|---|---|
| PubChem CID | 57250494 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | ethyl 2-[3,3-bis(4-methoxyphenyl)prop-2-enoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)C=C(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-4-27-21(24)14-22-20(23)13-19(15-5-9-17(25-2)10-6-15)16-7-11-18(26-3)12-8-16/h5-13H,4,14H2,1-3H3,(H,22,23) |
| InChIKey | SHNOHIVAGIHFSD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|