C28H42O8 — CID 95932035
diethyl 2-[[2-[2,2-bis(ethoxycarbonyl)pentyl]phenyl]methyl]-2-propylpropanedioate (PubChem CID 95932035) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is diethyl 2-[[2-[2,2-bis(ethoxycarbonyl)pentyl]phenyl]methyl]-2-propylpropanedioate.
| Compound Name | diethyl 2-[[2-[2,2-bis(ethoxycarbonyl)pentyl]phenyl]methyl]-2-propylpropanedioate |
|---|---|
| PubChem CID | 95932035 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | diethyl 2-[[2-[2,2-bis(ethoxycarbonyl)pentyl]phenyl]methyl]-2-propylpropanedioate |
| SMILES | CCCC(Cc1ccccc1CC(CCC)(C(=O)OCC)C(=O)OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C28H42O8/c1-7-17-27(23(29)33-9-3,24(30)34-10-4)19-21-15-13-14-16-22(21)20-28(18-8-2,25(31)35-11-5)26(32)36-12-6/h13-16H,7-12,17-20H2,1-6H3 |
| InChIKey | VZNNGXJWYXEYEC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|