C21H32O6 — CID 54069525
diethyl 2-[(2,3-dimethoxyphenyl)methyl]-2-pentylpropanedioate (PubChem CID 54069525) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is diethyl 2-[(2,3-dimethoxyphenyl)methyl]-2-pentylpropanedioate.
| Compound Name | diethyl 2-[(2,3-dimethoxyphenyl)methyl]-2-pentylpropanedioate |
|---|---|
| PubChem CID | 54069525 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | diethyl 2-[(2,3-dimethoxyphenyl)methyl]-2-pentylpropanedioate |
| SMILES | CCCCCC(Cc1cccc(OC)c1OC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C21H32O6/c1-6-9-10-14-21(19(22)26-7-2,20(23)27-8-3)15-16-12-11-13-17(24-4)18(16)25-5/h11-13H,6-10,14-15H2,1-5H3 |
| InChIKey | MFKLYRFQZWFOKH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|