C18H22N2O8 — CID 58481173
diethyl 2-acetamido-2-[(4-acetyl-3-nitrophenyl)methyl]propanedioate (PubChem CID 58481173) has the molecular formula C18H22N2O8 and a molecular weight of 394.38 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(4-acetyl-3-nitrophenyl)methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(4-acetyl-3-nitrophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 58481173 |
| Molecular Formula | C18H22N2O8 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | diethyl 2-acetamido-2-[(4-acetyl-3-nitrophenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc(C(C)=O)c([N+](=O)[O-])c1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H22N2O8/c1-5-27-16(23)18(19-12(4)22,17(24)28-6-2)10-13-7-8-14(11(3)21)15(9-13)20(25)26/h7-9H,5-6,10H2,1-4H3,(H,19,22) |
| InChIKey | WKCWMAWIDFNGBS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|