C26H27FINO2 — CID 175563039
ethyl 3-[benzyl(1-phenylethyl)amino]-3-(2-fluoro-3-iodophenyl)propanoate (PubChem CID 175563039) has the molecular formula C26H27FINO2 and a molecular weight of 531.41 g/mol. Its IUPAC name is ethyl 3-[benzyl(1-phenylethyl)amino]-3-(2-fluoro-3-iodophenyl)propanoate.
| Compound Name | ethyl 3-[benzyl(1-phenylethyl)amino]-3-(2-fluoro-3-iodophenyl)propanoate |
|---|---|
| PubChem CID | 175563039 |
| Molecular Formula | C26H27FINO2 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | ethyl 3-[benzyl(1-phenylethyl)amino]-3-(2-fluoro-3-iodophenyl)propanoate |
| SMILES | CCOC(=O)CC(c1cccc(I)c1F)N(Cc1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C26H27FINO2/c1-3-31-25(30)17-24(22-15-10-16-23(28)26(22)27)29(18-20-11-6-4-7-12-20)19(2)21-13-8-5-9-14-21/h4-16,19,24H,3,17-18H2,1-2H3 |
| InChIKey | QBAWRSRCEIUGLW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|