C10H13ClFN3O — CID 116849471
2-amino-2-(2-chloro-5-fluoro-4-methylphenyl)-N'-methylacetohydrazide (PubChem CID 116849471) has the molecular formula C10H13ClFN3O and a molecular weight of 245.69 g/mol. Its IUPAC name is 2-amino-2-(2-chloro-5-fluoro-4-methylphenyl)-N'-methylacetohydrazide.
| Compound Name | 2-amino-2-(2-chloro-5-fluoro-4-methylphenyl)-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 116849471 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-amino-2-(2-chloro-5-fluoro-4-methylphenyl)-N'-methylacetohydrazide |
| SMILES | CNNC(=O)C(N)c1cc(F)c(C)cc1Cl |
| InChI | InChI=1S/C10H13ClFN3O/c1-5-3-7(11)6(4-8(5)12)9(13)10(16)15-14-2/h3-4,9,14H,13H2,1-2H3,(H,15,16) |
| InChIKey | VLUJYJDPQDBYKV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|