C11H12F2O2 — CID 58950420
4-(2,5-difluorophenyl)-3-methylbutanoic acid (PubChem CID 58950420) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-3-methylbutanoic acid.
| Compound Name | 4-(2,5-difluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 58950420 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-(2,5-difluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C11H12F2O2/c1-7(5-11(14)15)4-8-6-9(12)2-3-10(8)13/h2-3,6-7H,4-5H2,1H3,(H,14,15) |
| InChIKey | NWXZRNLKTKFSOD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |