C14H18F2N2O3 — CID 63791386
3-[(2,5-difluorophenyl)methylcarbamoyl-ethylamino]butanoic acid (PubChem CID 63791386) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methylcarbamoyl-ethylamino]butanoic acid.
| Compound Name | 3-[(2,5-difluorophenyl)methylcarbamoyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 63791386 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methylcarbamoyl-ethylamino]butanoic acid |
| SMILES | CCN(C(=O)NCc1cc(F)ccc1F)C(C)CC(=O)O |
| InChI | InChI=1S/C14H18F2N2O3/c1-3-18(9(2)6-13(19)20)14(21)17-8-10-7-11(15)4-5-12(10)16/h4-5,7,9H,3,6,8H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | PKEQJTZRJYJUQX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |