5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid

C10H12Cl2O2S — CID 62932967

IUPAC5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid
SMILESCC(CCc1cc(Cl)sc1Cl)CC(=O)O
InChIInChI=1S/C10H12Cl2O2S/c1-6(4-9(13)14)2-3-7-5-8(11)15-10(7)12/h5-6H,2-4H2,1H3,(H,13,14)
InChIKeyFFLNEDPRXYEHJJ-UHFFFAOYSA-N
MW267.18 g/mol
LogP4.10
Rot. Bonds5

About 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid

5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid (PubChem CID 62932967) has the molecular formula C10H12Cl2O2S and a molecular weight of 267.18 g/mol. Its IUPAC name is 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid.

Molecular Properties

Compound Name5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid
PubChem CID62932967
Molecular FormulaC10H12Cl2O2S
Molecular Weight267.18 g/mol
Exact Mass265.99
IUPAC Name5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid
SMILESCC(CCc1cc(Cl)sc1Cl)CC(=O)O
InChIInChI=1S/C10H12Cl2O2S/c1-6(4-9(13)14)2-3-7-5-8(11)15-10(7)12/h5-6H,2-4H2,1H3,(H,13,14)
InChIKeyFFLNEDPRXYEHJJ-UHFFFAOYSA-N
XLogP4.10
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.18
LogP ≤ 54.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid?
The IUPAC name of 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid (CID 62932967) is 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid.
What is the SMILES notation for 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid?
The canonical SMILES for 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid is CC(CCc1cc(Cl)sc1Cl)CC(=O)O.
What is the InChIKey of 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid?
The InChIKey is FFLNEDPRXYEHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O2S/c1-6(4-9(13)14)2-3-7-5-8(11)15-10(7)12/h5-6H,2-4H2,1H3,(H,13,14).
What are the key properties of 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid?
5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid has a molecular weight of 267.18 g/mol, XLogP of 4.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid is sourced from PubChem (CID 62932967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).