C10H12Cl2O2S — CID 62932967
5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid (PubChem CID 62932967) has the molecular formula C10H12Cl2O2S and a molecular weight of 267.18 g/mol. Its IUPAC name is 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid.
| Compound Name | 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 62932967 |
| Molecular Formula | C10H12Cl2O2S |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 5-(2,5-dichlorothiophen-3-yl)-3-methylpentanoic acid |
| SMILES | CC(CCc1cc(Cl)sc1Cl)CC(=O)O |
| InChI | InChI=1S/C10H12Cl2O2S/c1-6(4-9(13)14)2-3-7-5-8(11)15-10(7)12/h5-6H,2-4H2,1H3,(H,13,14) |
| InChIKey | FFLNEDPRXYEHJJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |