C10H13Cl2NO2S — CID 122039983
2-[(2,5-dichlorothiophen-3-yl)methyl-propylamino]acetic acid (PubChem CID 122039983) has the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)methyl-propylamino]acetic acid.
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)methyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 122039983 |
| Molecular Formula | C10H13Cl2NO2S |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)methyl-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)Cc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H13Cl2NO2S/c1-2-3-13(6-9(14)15)5-7-4-8(11)16-10(7)12/h4H,2-3,5-6H2,1H3,(H,14,15) |
| InChIKey | VPYMEEPPOLSRCL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |