C11H17NO2S — CID 65064587
2-[(5-methylthiophen-2-yl)methyl-propylamino]acetic acid (PubChem CID 65064587) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-[(5-methylthiophen-2-yl)methyl-propylamino]acetic acid.
| Compound Name | 2-[(5-methylthiophen-2-yl)methyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 65064587 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[(5-methylthiophen-2-yl)methyl-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)Cc1ccc(C)s1 |
| InChI | InChI=1S/C11H17NO2S/c1-3-6-12(8-11(13)14)7-10-5-4-9(2)15-10/h4-5H,3,6-8H2,1-2H3,(H,13,14) |
| InChIKey | HDIFWSYWIXCEFH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |