C10H15NOS — CID 139526737
N-ethyl-N-[(5-methylthiophen-2-yl)methyl]acetamide (PubChem CID 139526737) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is N-ethyl-N-[(5-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-ethyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 139526737 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | N-ethyl-N-[(5-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCN(Cc1ccc(C)s1)C(C)=O |
| InChI | InChI=1S/C10H15NOS/c1-4-11(9(3)12)7-10-6-5-8(2)13-10/h5-6H,4,7H2,1-3H3 |
| InChIKey | TVKZMTKZWGPFNN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |