C15H27NOSi — CID 163217171
N-[[2-[tert-butyl(dimethyl)silyl]-4,5-dimethylphenyl]methyl]hydroxylamine (PubChem CID 163217171) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is N-[[2-[tert-butyl(dimethyl)silyl]-4,5-dimethylphenyl]methyl]hydroxylamine.
| Compound Name | N-[[2-[tert-butyl(dimethyl)silyl]-4,5-dimethylphenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 163217171 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | N-[[2-[tert-butyl(dimethyl)silyl]-4,5-dimethylphenyl]methyl]hydroxylamine |
| SMILES | Cc1cc(CNO)c([Si](C)(C)C(C)(C)C)cc1C |
| InChI | InChI=1S/C15H27NOSi/c1-11-8-13(10-16-17)14(9-12(11)2)18(6,7)15(3,4)5/h8-9,16-17H,10H2,1-7H3 |
| InChIKey | SKSGUPHSCGVKFD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|