C12H19NO4 — CID 117355207
1-[2,6-dimethoxy-4-(methoxymethyl)phenyl]-N-methoxymethanamine (PubChem CID 117355207) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[2,6-dimethoxy-4-(methoxymethyl)phenyl]-N-methoxymethanamine.
| Compound Name | 1-[2,6-dimethoxy-4-(methoxymethyl)phenyl]-N-methoxymethanamine |
|---|---|
| PubChem CID | 117355207 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-[2,6-dimethoxy-4-(methoxymethyl)phenyl]-N-methoxymethanamine |
| SMILES | COCc1cc(OC)c(CNOC)c(OC)c1 |
| InChI | InChI=1S/C12H19NO4/c1-14-8-9-5-11(15-2)10(7-13-17-4)12(6-9)16-3/h5-6,13H,7-8H2,1-4H3 |
| InChIKey | JAWZZNAPCGGGDA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|